CymitQuimica logo

CAS 1160247-20-0

:

7-(1,1-Dimethylethyl) 2-(phenylmethyl) 2,7-diazaspiro[4.4]nonane-2,4,7-tricarboxylate

Description:
7-(1,1-Dimethylethyl) 2-(phenylmethyl) 2,7-diazaspiro[4.4]nonane-2,4,7-tricarboxylate is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and multiple carboxylate functional groups. The presence of the spiro system contributes to its three-dimensional conformation, potentially influencing its reactivity and interactions with biological systems. The compound features a tert-butyl group, which enhances its lipophilicity, and a phenylmethyl group that may provide additional steric hindrance and electronic effects. The tricarboxylate moiety suggests potential for chelation with metal ions or participation in various chemical reactions, making it of interest in fields such as medicinal chemistry and materials science. Its specific properties, such as solubility, stability, and biological activity, would depend on the surrounding environment and conditions. As with many complex organic molecules, understanding its behavior in different contexts is crucial for applications in drug design or as a chemical intermediate. Further studies would be necessary to elucidate its full range of characteristics and potential uses.
Formula:C21H28N2O6
InChI:InChI=1S/C21H28N2O6/c1-20(2,3)29-19(27)22-10-9-21(13-22)14-23(11-16(21)17(24)25)18(26)28-12-15-7-5-4-6-8-15/h4-8,16H,9-14H2,1-3H3,(H,24,25)
InChI key:InChIKey=GBTIZYRCMIVLGY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C2(CN(C(OCC3=CC=CC=C3)=O)C1)CN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 2,7-Diazaspiro[4.4]nonane-2,4,7-tricarboxylic acid, 7-(1,1-dimethylethyl) 2-(phenylmethyl) ester
  • 7-(1,1-Dimethylethyl) 2-(phenylmethyl) 2,7-diazaspiro[4.4]nonane-2,4,7-tricarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.