CAS 1160247-32-4

1,1-Dimethylethyl 6-chloro-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 6-chloro-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-1′-carboxylate, identified by its CAS number 1160247-32-4, is a chemical compound characterized by its complex molecular structure, which includes a spirocyclic framework. This compound features a piperidine ring fused to an indene moiety, contributing to its unique three-dimensional shape. The presence of a chloro substituent and a carboxylate group indicates potential reactivity and solubility characteristics, which may influence its behavior in various chemical environments. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The dimethyl group suggests steric hindrance, which can affect the compound's interaction with biological targets. Additionally, the presence of multiple functional groups may provide sites for further chemical modification, enhancing its utility in synthetic applications. Overall, this compound's structural features suggest it may possess interesting pharmacological properties, warranting further investigation in relevant scientific fields.

Formula: C₁₈H₂₄ClNO₂

InChI: InChI=1S/C18H24ClNO2/c1-17(2,3)22-16(21)20-10-8-18(9-11-20)7-6-13-4-5-14(19)12-15(13)18/h4-5,12H,6-11H2,1-3H3

InChI key: InChIKey=VYXHNAJIDSFZGU-UHFFFAOYSA-N

SMILES: ClC=1C=C2C3(CCC2=CC1)CCN(C(OC(C)(C)C)=O)CC3

Synonyms:

• 1,1-Dimethylethyl 6-chloro-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-1′-carboxylate
• Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 6-chloro-2,3-dihydro-, 1,1-dimethylethyl ester