CAS 1160247-34-6

1,1-Dimethylethyl 2,3-dihydro-5-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 2,3-dihydro-5-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate, with the CAS number 1160247-34-6, is a chemical compound characterized by its complex molecular structure, which includes a spirocyclic framework. This compound features a piperidine ring fused to an indene moiety, contributing to its unique three-dimensional shape. The presence of the dimethyl group and the carboxylate functional group suggests potential for various chemical reactivity and interactions. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in medicinal chemistry. The spiro structure often imparts rigidity, which can influence the compound's pharmacokinetics and binding properties. Additionally, the presence of multiple functional groups may allow for further derivatization, enhancing its utility in synthetic applications. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions, such as solvent and temperature. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₉H₂₇NO₂

InChI: InChI=1S/C19H27NO2/c1-14-5-6-16-15(13-14)7-8-19(16)9-11-20(12-10-19)17(21)22-18(2,3)4/h5-6,13H,7-12H2,1-4H3

InChI key: InChIKey=ONGIDRSYEYSVOQ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC2(C=3C(CC2)=CC(C)=CC3)CC1

Synonyms:

• 1,1-Dimethylethyl 2,3-dihydro-5-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate
• Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 2,3-dihydro-5-methyl-, 1,1-dimethylethyl ester