CAS 1160247-37-9

1,1-Dimethylethyl 2,3-dihydro-7-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 2,3-dihydro-7-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate, identified by its CAS number 1160247-37-9, is a chemical compound characterized by its complex structure that includes a spirocyclic framework. This compound features a piperidine ring fused with an indene moiety, contributing to its unique three-dimensional arrangement. The presence of the dimethyl group and the carboxylate functional group suggests potential reactivity and solubility characteristics that may be influenced by steric hindrance and electronic effects. Typically, such compounds may exhibit interesting biological activities, making them of interest in medicinal chemistry. The molecular structure implies potential applications in drug development or as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety data and handling precautions should be considered, especially if the compound exhibits toxicity or environmental hazards.

Formula: C₁₉H₂₇NO₂

InChI: InChI=1S/C19H27NO2/c1-14-6-5-7-15-8-9-19(16(14)15)10-12-20(13-11-19)17(21)22-18(2,3)4/h5-7H,8-13H2,1-4H3

InChI key: InChIKey=GOEKBNCZYFOMMX-UHFFFAOYSA-N

SMILES: CC1=C2C3(CCC2=CC=C1)CCN(C(OC(C)(C)C)=O)CC3

Synonyms:

• Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 2,3-dihydro-7-methyl-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2,3-dihydro-7-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate