CAS 1160247-38-0

1,1-Dimethylethyl 7-bromo-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 7-bromo-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-1′-carboxylate, with the CAS number 1160247-38-0, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of both indene and piperidine. This compound features a bromine atom, contributing to its reactivity and potential applications in organic synthesis. The presence of the dimethyl group enhances its steric properties, influencing its interactions with other molecules. As an ester, it may exhibit typical ester characteristics such as volatility and solubility in organic solvents. The compound's structural features suggest potential biological activity, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, including bromination and esterification. Overall, this compound represents a fascinating example of synthetic organic chemistry, with potential implications in drug development and material science. Further studies would be necessary to fully elucidate its properties and applications.

Formula: C₁₈H₂₄BrNO₂

InChI: InChI=1S/C18H24BrNO2/c1-17(2,3)22-16(21)20-11-9-18(10-12-20)8-7-13-5-4-6-14(19)15(13)18/h4-6H,7-12H2,1-3H3

InChI key: InChIKey=MUPLPTOMZDEVMZ-UHFFFAOYSA-N

SMILES: BrC1=C2C3(CCC2=CC=C1)CCN(C(OC(C)(C)C)=O)CC3

Synonyms:

• Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 7-bromo-2,3-dihydro-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 7-bromo-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-1′-carboxylate

tert-Butyl 7-bromo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate

CAS: 1160247-38-0

tert-Butyl 7-bromo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate

Purity: 97%

Molecular weight: 366.29g/mol

Ref: 54-OR1034644