CAS 1160247-49-3

1,1-Dimethylethyl 2,3-dihydro-7-methyl-3-oxospiro[1H-indene-1,4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 2,3-dihydro-7-methyl-3-oxospiro[1H-indene-1,4′-piperidine]-1′-carboxylate, identified by its CAS number 1160247-49-3, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of both indene and piperidine. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group indicates steric hindrance, which can influence its chemical behavior and interactions with other molecules. Additionally, the keto group within the structure suggests potential for tautomerization and reactivity in various chemical environments. The compound's molecular framework may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its stability and reactivity would be assessed through various analytical methods. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry due to its intricate structure and potential applications.

Formula: C₁₉H₂₅NO₃

InChI: InChI=1S/C19H25NO3/c1-13-6-5-7-14-15(21)12-19(16(13)14)8-10-20(11-9-19)17(22)23-18(2,3)4/h5-7H,8-12H2,1-4H3

InChI key: InChIKey=UVMOIFKGIKWCOP-UHFFFAOYSA-N

SMILES: CC1=C2C3(CC(=O)C2=CC=C1)CCN(C(OC(C)(C)C)=O)CC3

Synonyms:

• 1,1-Dimethylethyl 2,3-dihydro-7-methyl-3-oxospiro[1H-indene-1,4′-piperidine]-1′-carboxylate
• tert-Butyl 7-methyl-3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate
• Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 2,3-dihydro-7-methyl-3-oxo-, 1,1-dimethylethyl ester