CymitQuimica logo

CAS 1160247-50-6

:

1,1-Dimethylethyl 3-amino-2,3-dihydro-7-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate

Description:
1,1-Dimethylethyl 3-amino-2,3-dihydro-7-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate, with CAS number 1160247-50-6, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of both indene and piperidine. This compound features a dimethyl group that enhances its steric properties, potentially influencing its reactivity and interactions with biological targets. The presence of an amino group suggests potential for hydrogen bonding, which may play a role in its solubility and biological activity. The carboxylate functional group indicates that it may exhibit acidic properties, which could affect its behavior in various chemical environments. Additionally, the compound's structural intricacies may contribute to its pharmacological profile, making it of interest in medicinal chemistry. Overall, the combination of these functional groups and structural features suggests that this compound could have diverse applications, particularly in drug development and synthesis. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C19H28N2O2
InChI:InChI=1S/C19H28N2O2/c1-13-6-5-7-14-15(20)12-19(16(13)14)8-10-21(11-9-19)17(22)23-18(2,3)4/h5-7,15H,8-12,20H2,1-4H3
InChI key:InChIKey=UQMQQMHXXSGSRR-UHFFFAOYSA-N
SMILES:CC1=C2C3(CC(N)C2=CC=C1)CCN(C(OC(C)(C)C)=O)CC3
Synonyms:
  • Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 3-amino-2,3-dihydro-7-methyl-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 3-amino-2,3-dihydro-7-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.