CAS 1160247-54-0
:1,1-Dimethylethyl 3-amino-2,3-dihydro-5-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate
Description:
1,1-Dimethylethyl 3-amino-2,3-dihydro-5-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate, with the CAS number 1160247-54-0, is a chemical compound characterized by its complex structure, which includes a spirocyclic framework. This compound features a piperidine ring and an indene moiety, contributing to its unique chemical properties. The presence of the dimethyl group and the amino functional group suggests potential for various interactions, including hydrogen bonding and steric effects. The carboxylate group indicates that it may exhibit acidic properties, which could influence its reactivity and solubility in different solvents. Such compounds are often of interest in medicinal chemistry due to their potential biological activity, which may include effects on neurotransmitter systems or other physiological pathways. The specific stereochemistry and substituent positions can significantly affect the compound's pharmacological profile, making it a candidate for further research in drug development or as a lead compound in synthetic chemistry.
Formula:C19H28N2O2
InChI:InChI=1S/C19H28N2O2/c1-13-5-6-15-14(11-13)16(20)12-19(15)7-9-21(10-8-19)17(22)23-18(2,3)4/h5-6,11,16H,7-10,12,20H2,1-4H3
InChI key:InChIKey=KGAVNJKNZBBSRY-UHFFFAOYSA-N
SMILES:NC1CC2(C=3C1=CC(C)=CC3)CCN(C(OC(C)(C)C)=O)CC2
Synonyms:- Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 3-amino-2,3-dihydro-5-methyl-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3-amino-2,3-dihydro-5-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.