CAS 1160247-56-2
:1′-[(1,1-Dimethylethoxy)carbonyl]-2,3-dihydro-5,6-dimethoxyspiro[1H-indene-1,4′-piperidine]-3-acetic acid
Description:
1′-[(1,1-Dimethylethoxy)carbonyl]-2,3-dihydro-5,6-dimethoxyspiro[1H-indene-1,4′-piperidine]-3-acetic acid, with CAS number 1160247-56-2, is a complex organic compound characterized by its spirocyclic structure, which includes a piperidine ring fused to an indene moiety. This compound features multiple functional groups, including an acetic acid moiety and dimethoxy substituents, contributing to its chemical reactivity and potential biological activity. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it may exhibit unique steric and electronic properties, influencing its interactions in chemical reactions or biological systems. The compound's solubility, stability, and reactivity can vary significantly based on its molecular structure and the environment in which it is placed. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of new pharmaceuticals. Further studies would be necessary to elucidate its specific properties, including its pharmacokinetics, mechanism of action, and potential uses in various fields.
Formula:C22H31NO6
InChI:InChI=1S/C22H31NO6/c1-21(2,3)29-20(26)23-8-6-22(7-9-23)13-14(10-19(24)25)15-11-17(27-4)18(28-5)12-16(15)22/h11-12,14H,6-10,13H2,1-5H3,(H,24,25)
InChI key:InChIKey=FXVKNSONWCCSIG-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1CC2(C=3C1=CC(OC)=C(OC)C3)CCN(C(OC(C)(C)C)=O)CC2
Synonyms:- 1′-[(1,1-Dimethylethoxy)carbonyl]-2,3-dihydro-5,6-dimethoxyspiro[1H-indene-1,4′-piperidine]-3-acetic acid
- Spiro[1H-indene-1,4′-piperidine]-3-acetic acid, 1′-[(1,1-dimethylethoxy)carbonyl]-2,3-dihydro-5,6-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.