CAS 1160247-58-4
:1,1-Dimethylethyl 3-amino-7-bromo-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-1′-carboxylate
Description:
1,1-Dimethylethyl 3-amino-7-bromo-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-1′-carboxylate, identified by its CAS number 1160247-58-4, is a complex organic compound characterized by its unique structural features. It contains a spirocyclic framework, which is a hallmark of many biologically active molecules, suggesting potential pharmacological properties. The presence of a bromine atom indicates that it may exhibit halogen-related reactivity, which can influence its chemical behavior and interactions. The amino group suggests potential for hydrogen bonding, enhancing solubility and reactivity in biological systems. Additionally, the dimethyl group contributes to steric hindrance, which may affect the compound's conformation and interactions with biological targets. This compound is likely to be of interest in medicinal chemistry, particularly in the development of new therapeutic agents, due to its intricate structure and the potential for diverse biological activity. However, specific properties such as solubility, melting point, and stability would require empirical investigation for comprehensive characterization.
Formula:C18H25BrN2O2
InChI:InChI=1S/C18H25BrN2O2/c1-17(2,3)23-16(22)21-9-7-18(8-10-21)11-14(20)12-5-4-6-13(19)15(12)18/h4-6,14H,7-11,20H2,1-3H3
InChI key:InChIKey=NIBUWELKNQAJIR-UHFFFAOYSA-N
SMILES:BrC1=C2C3(CC(N)C2=CC=C1)CCN(C(OC(C)(C)C)=O)CC3
Synonyms:- Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 3-amino-7-bromo-2,3-dihydro-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3-amino-7-bromo-2,3-dihydrospiro[1H-indene-1,4′-piperidine]-1′-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.