CymitQuimica logo

CAS 1160247-60-8

:

1,1-Dimethylethyl 5-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate

Description:
1,1-Dimethylethyl 5-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate, identified by its CAS number 1160247-60-8, is a chemical compound characterized by its complex structure, which includes a spirocyclic framework. This compound features a piperidine ring fused with an indene moiety, contributing to its unique chemical properties. The presence of the tert-butyl group (1,1-dimethylethyl) and a carboxylate functional group enhances its reactivity and solubility in various organic solvents. The spiro arrangement often imparts interesting stereochemical properties, which can influence its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as a building block in organic synthesis. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or experimental determination.
Formula:C19H25NO2
InChI:InChI=1S/C19H25NO2/c1-14-5-6-16-15(13-14)7-8-19(16)9-11-20(12-10-19)17(21)22-18(2,3)4/h5-8,13H,9-12H2,1-4H3
InChI key:InChIKey=KRZLIHJCCINWTR-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC2(C=3C(C=C2)=CC(C)=CC3)CC1
Synonyms:
  • 1,1-Dimethylethyl 5-methylspiro[1H-indene-1,4′-piperidine]-1′-carboxylate
  • Spiro[1H-indene-1,4′-piperidine]-1′-carboxylic acid, 5-methyl-, 1,1-dimethylethyl ester
Found 2 products.