CAS 1160247-65-3

1,1-Dimethylethyl 3,4-dihydrospiro[isoquinoline-1(2H),4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 3,4-dihydrospiro[isoquinoline-1(2H),4′-piperidine]-1′-carboxylate, identified by its CAS number 1160247-65-3, is a complex organic compound characterized by its unique spirocyclic structure. This substance features a combination of an isoquinoline and a piperidine moiety, which contributes to its potential biological activity. The presence of the dimethyl group enhances its steric properties, influencing its reactivity and interaction with biological targets. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The carboxylate functional group suggests potential for forming salts or esters, which can affect solubility and bioavailability. Additionally, the compound's structural complexity may lead to interesting stereochemical considerations, impacting its overall behavior in chemical reactions and biological systems. As with many organic compounds, its stability, solubility, and reactivity will depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₈H₂₆N₂O₂

InChI: InChI=1S/C18H26N2O2/c1-17(2,3)22-16(21)20-12-9-18(10-13-20)15-7-5-4-6-14(15)8-11-19-18/h4-7,19H,8-13H2,1-3H3

InChI key: InChIKey=AHNPIPNEOCUYGQ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC2(C=3C(CCN2)=CC=CC3)CC1

Synonyms:

• Spiro[isoquinoline-1(2H),4′-piperidine]-1′-carboxylic acid, 3,4-dihydro-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3,4-dihydrospiro[isoquinoline-1(2H),4′-piperidine]-1′-carboxylate

Tert-Butyl 3,4-Dihydro-2H-Spiro[Isoquinoline-1,4-Piperidine]-1-Carboxylate

CAS: 1160247-65-3

Formula: C₁₈H₂₆N₂O₂

Purity: 95%

Molecular weight: 302.4112

Ref: IN-DA00HD8I