CAS 1160247-72-2

1,1-Dimethylethyl 4-bromo-1,2-dihydrospiro[3H-indole-3,4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 4-bromo-1,2-dihydrospiro[3H-indole-3,4′-piperidine]-1′-carboxylate, with the CAS number 1160247-72-2, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both indole and piperidine moieties. The presence of a bromine atom introduces notable reactivity, potentially influencing its chemical behavior and interactions. The dimethyl group contributes to steric hindrance, which can affect the compound's conformation and reactivity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further investigation in medicinal chemistry. Its carboxylate functional group suggests potential for forming salts or participating in esterification reactions. As with many organic compounds, its solubility, stability, and reactivity can vary significantly depending on the solvent and environmental conditions. Overall, this compound's intricate structure and functional groups position it as a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₁₇H₂₃BrN₂O₂

InChI: InChI=1S/C17H23BrN2O2/c1-16(2,3)22-15(21)20-9-7-17(8-10-20)11-19-13-6-4-5-12(18)14(13)17/h4-6,19H,7-11H2,1-3H3

InChI key: InChIKey=HLMMEAFIUWRKDO-UHFFFAOYSA-N

SMILES: BrC1=C2C3(CNC2=CC=C1)CCN(C(OC(C)(C)C)=O)CC3

Synonyms:

• Spiro[3H-indole-3,4′-piperidine]-1′-carboxylic acid, 4-bromo-1,2-dihydro-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-bromo-1,2-dihydrospiro[3H-indole-3,4′-piperidine]-1′-carboxylate