CymitQuimica logo

CAS 1160247-78-8

:

1,1-Dimethylethyl 1′,4′-dihydro-2′,4′-dioxospiro[piperidine-4,3′(2′H)-quinoline]-1-carboxylate

Description:
1,1-Dimethylethyl 1′,4′-dihydro-2′,4′-dioxospiro[piperidine-4,3′(2′H)-quinoline]-1-carboxylate, identified by its CAS number 1160247-78-8, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both piperidine and quinoline moieties. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of two carbonyl groups (dioxo) suggests that it may exhibit significant reactivity, particularly in nucleophilic addition reactions. The dimethyl group attached to the carbon backbone indicates steric hindrance, which can influence the compound's conformational stability and interaction with other molecules. Such structural features may impart interesting biological activities, making it a candidate for further pharmacological studies. Additionally, the compound's synthesis and characterization would typically involve advanced organic chemistry techniques, including spectroscopy and chromatography, to confirm its purity and structural integrity. Overall, this compound represents a fascinating area of study within medicinal chemistry and organic synthesis.
Formula:C18H22N2O4
InChI:InChI=1S/C18H22N2O4/c1-17(2,3)24-16(23)20-10-8-18(9-11-20)14(21)12-6-4-5-7-13(12)19-15(18)22/h4-7H,8-11H2,1-3H3,(H,19,22)
InChI key:InChIKey=QOOQGSVGCJWBMB-UHFFFAOYSA-N
SMILES:O=C1C2(C(=O)NC=3C1=CC=CC3)CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1,1-Dimethylethyl 1′,4′-dihydro-2′,4′-dioxospiro[piperidine-4,3′(2′H)-quinoline]-1-carboxylate
  • Spiro[piperidine-4,3′(2′H)-quinoline]-1-carboxylic acid, 1′,4′-dihydro-2′,4′-dioxo-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.