CAS 1160248-46-3

6-Bromo-1′-methylspiro[3H-indole-3,4′-piperidin]-2(1H)-one

Description:

6-Bromo-1′-methylspiro[3H-indole-3,4′-piperidin]-2(1H)-one is a chemical compound characterized by its unique spirocyclic structure, which combines an indole and a piperidine moiety. The presence of a bromine atom at the 6-position of the indole ring contributes to its reactivity and potential biological activity. This compound features a carbonyl group, indicative of its classification as a ketone, which can influence its chemical behavior and interactions. The methyl group attached to the spiro center enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. Due to its structural features, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization involve standard organic chemistry techniques, and it may serve as a lead compound for further development in drug discovery. As with many such compounds, understanding its stability, reactivity, and biological interactions is crucial for potential applications in pharmaceuticals or other fields.

Formula: C₁₃H₁₅BrN₂O

InChI: InChI=1S/C13H15BrN2O/c1-16-6-4-13(5-7-16)10-3-2-9(14)8-11(10)15-12(13)17/h2-3,8H,4-7H2,1H3,(H,15,17)

InChI key: InChIKey=SOWJEYXVGLHJTF-UHFFFAOYSA-N

SMILES: O=C1C2(C=3C(N1)=CC(Br)=CC3)CCN(C)CC2

Synonyms:

• Spiro[3H-indole-3,4′-piperidin]-2(1H)-one, 6-bromo-1′-methyl-
• 6-Bromo-1′-methylspiro[3H-indole-3,4′-piperidin]-2(1H)-one