CAS 1160248-82-7

4-Ethyl-5-methyl-3-thiophenecarbonyl chloride

Description:

4-Ethyl-5-methyl-3-thiophenecarbonyl chloride is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features an acyl chloride functional group, indicating that it can react with nucleophiles, making it useful in various synthetic applications. The presence of ethyl and methyl substituents on the thiophene ring contributes to its unique reactivity and physical properties, such as solubility and boiling point. Typically, compounds like this exhibit moderate to high reactivity due to the electrophilic nature of the carbonyl carbon in the acyl chloride group. Additionally, the thiophene moiety can participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic acyl substitution. Safety precautions are essential when handling this compound, as acyl chlorides can be corrosive and may release harmful gases upon reaction with water or moisture. Overall, 4-Ethyl-5-methyl-3-thiophenecarbonyl chloride is a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₈H₉ClOS

InChI: InChI=1S/C8H9ClOS/c1-3-6-5(2)11-4-7(6)8(9)10/h4H,3H2,1-2H3

InChI key: InChIKey=JKGFZBLTURETDI-UHFFFAOYSA-N

SMILES: C(C)C=1C(C(Cl)=O)=CSC1C

Synonyms:

• 3-Thiophenecarbonyl chloride, 4-ethyl-5-methyl-
• 4-Ethyl-5-methyl-3-thiophenecarbonyl chloride