CAS 1160248-88-3

4,5,6,7-Tetrahydro-6-methylbenzo[b]thiophene-3-carbonyl chloride

Description:

4,5,6,7-Tetrahydro-6-methylbenzo[b]thiophene-3-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a tetrahydrobenzo[b]thiophene core with a carbonyl chloride functional group. This compound features a fused ring system that incorporates both carbon and sulfur atoms, contributing to its distinct chemical properties. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such derivatives may exhibit biological activity. Additionally, the compound's reactivity can be influenced by the presence of the methyl group, which may affect steric and electronic properties. As with many organochlorine compounds, handling requires caution due to potential toxicity and environmental concerns. Overall, 4,5,6,7-Tetrahydro-6-methylbenzo[b]thiophene-3-carbonyl chloride is a versatile compound with significant implications in synthetic chemistry.

Formula: C₁₀H₁₁ClOS

InChI: InChI=1S/C10H11ClOS/c1-6-2-3-7-8(10(11)12)5-13-9(7)4-6/h5-6H,2-4H2,1H3

InChI key: InChIKey=RUZYUHUCGVUZGR-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(SC1)CC(C)CC2

Synonyms:

• 4,5,6,7-Tetrahydro-6-methylbenzo[b]thiophene-3-carbonyl chloride
• Benzo[b]thiophene-3-carbonyl chloride, 4,5,6,7-tetrahydro-6-methyl-