CAS 1160248-90-7

6-Methylbenzo[b]thiophene-3-carbonyl chloride

Description:

6-Methylbenzo[b]thiophene-3-carbonyl chloride is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring system substituted with a methyl group and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and thiophene compounds, such as stability and reactivity due to the presence of the carbonyl chloride, which is a reactive electrophile. The presence of the methyl group can influence its solubility and reactivity, making it more lipophilic. In terms of applications, compounds like this are often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to their ability to undergo various chemical transformations. Additionally, the carbonyl chloride moiety can participate in acylation reactions, making it a valuable intermediate in synthetic chemistry. Safety considerations should be taken into account when handling this compound, as carbonyl chlorides can be hazardous and require appropriate safety measures.

Formula: C₁₀H₇ClOS

InChI: InChI=1S/C10H7ClOS/c1-6-2-3-7-8(10(11)12)5-13-9(7)4-6/h2-5H,1H3

InChI key: InChIKey=OCMJJFRJVBNAMI-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C=2C(SC1)=CC(C)=CC2

Synonyms:

• 6-Methylbenzo[b]thiophene-3-carbonyl chloride
• Benzo[b]thiophene-3-carbonyl chloride, 6-methyl-