CAS 1160248-98-5

5-Methyl-4-phenyl-3-thiophenecarbonyl chloride

Description:

5-Methyl-4-phenyl-3-thiophenecarbonyl chloride is an organic compound characterized by its unique structure, which includes a thiophene ring, a carbonyl group, and a chlorine atom. This compound typically exhibits properties associated with acyl chlorides, such as being a reactive electrophile, making it useful in various synthetic applications, particularly in the formation of esters and amides. The presence of the methyl and phenyl groups contributes to its hydrophobic characteristics, while the thiophene ring adds to its aromatic nature, potentially influencing its reactivity and stability. As a carbonyl chloride, it is likely to be sensitive to moisture and can release hydrochloric acid upon hydrolysis. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals, where its reactivity can facilitate the introduction of functional groups. Safety precautions should be observed when handling this substance due to its corrosive nature and potential health hazards associated with exposure.

Formula: C₁₂H₉ClOS

InChI: InChI=1S/C12H9ClOS/c1-8-11(9-5-3-2-4-6-9)10(7-15-8)12(13)14/h2-7H,1H3

InChI key: InChIKey=BQTIHTVCLUNSIK-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C(=C(C)SC1)C2=CC=CC=C2

Synonyms:

• 3-Thiophenecarbonyl chloride, 5-methyl-4-phenyl-
• 5-Methyl-4-phenyl-3-thiophenecarbonyl chloride