CymitQuimica logo

CAS 1160249-05-7

:

4-Bromo-5-ethyl-2-thiophenecarbonyl chloride

Description:
4-Bromo-5-ethyl-2-thiophenecarbonyl chloride is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The compound features a bromine atom and an ethyl group attached to the thiophene, contributing to its unique reactivity and physical properties. The carbonyl chloride functional group indicates that it is an acyl chloride, making it reactive towards nucleophiles, which is useful in various synthetic applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle it with care due to its potential reactivity and toxicity, particularly in the presence of moisture, which can lead to hydrolysis. Its applications may include use in organic synthesis, particularly in the preparation of other chemical compounds or as an intermediate in pharmaceuticals and agrochemicals. As with all chemical substances, proper safety protocols should be followed when handling this compound.
Formula:C7H6BrClOS
InChI:InChI=1S/C7H6BrClOS/c1-2-5-4(8)3-6(11-5)7(9)10/h3H,2H2,1H3
InChI key:InChIKey=PLMQQVJPNPOWQW-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1SC(CC)=C(Br)C1
Synonyms:
  • 2-Thiophenecarbonyl chloride, 4-bromo-5-ethyl-
  • 4-Bromo-5-ethyl-2-thiophenecarbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.