CAS 1160249-22-8

4-Bromo-3-chlorobenzo[b]thiophene-2-carbonyl chloride

Description:

4-Bromo-3-chlorobenzo[b]thiophene-2-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with bromine and chlorine atoms, as well as a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased reactivity due to the presence of the carbonyl chloride group, which can participate in nucleophilic substitution reactions. The presence of bromine and chlorine substituents can also influence the compound's electronic properties, potentially enhancing its reactivity in various chemical transformations. Additionally, the thiophene ring contributes to the compound's aromaticity and may affect its solubility and stability in different solvents. Due to its structural features, this compound may find applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. However, handling should be approached with caution due to the potential toxicity associated with halogenated compounds.

Formula: C₉H₃BrCl₂OS

InChI: InChI=1S/C9H3BrCl2OS/c10-4-2-1-3-5-6(4)7(11)8(14-5)9(12)13/h1-3H

InChI key: InChIKey=HXAGCTPOQVVPJU-UHFFFAOYSA-N

SMILES: ClC=1C=2C(SC1C(Cl)=O)=CC=CC2Br

Synonyms:

• 4-Bromo-3-chlorobenzo[b]thiophene-2-carbonyl chloride
• Benzo[b]thiophene-2-carbonyl chloride, 4-bromo-3-chloro-