CAS 1160249-37-5

4-[(2-Chlorophenyl)methoxy]benzoyl chloride

Description:

4-[(2-Chlorophenyl)methoxy]benzoyl chloride, identified by its CAS number 1160249-37-5, is an organic compound characterized by the presence of a benzoyl chloride functional group and a methoxy group attached to a chlorophenyl moiety. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The chlorophenyl group contributes to its potential biological activity and can influence its solubility and stability in various solvents. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially enhancing its reactivity or selectivity in chemical reactions. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, where its ability to form covalent bonds with nucleophiles is advantageous. Proper handling and storage are essential due to its reactive nature and potential hazards associated with acyl chlorides.

Formula: C₁₄H₁₀Cl₂O₂

InChI: InChI=1S/C14H10Cl2O2/c15-13-4-2-1-3-11(13)9-18-12-7-5-10(6-8-12)14(16)17/h1-8H,9H2

InChI key: InChIKey=KZUWGBQDZRAHKH-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=CC=C1)C2=CC=C(C(Cl)=O)C=C2

Synonyms:

• 4-[(2-Chlorophenyl)methoxy]benzoyl chloride
• Benzoyl chloride, 4-[(2-chlorophenyl)methoxy]-
• 4-[(2-chlorobenzyl)oxy]benzoyl chloride