CAS 1160249-46-6
:4-(Cyclopentyloxy)-3-ethoxybenzoyl chloride
Description:
4-(Cyclopentyloxy)-3-ethoxybenzoyl chloride is an organic compound characterized by its functional groups and structural features. It contains a benzoyl chloride moiety, which is known for its reactivity due to the presence of the acyl chloride functional group, making it a useful intermediate in organic synthesis. The compound features a cyclopentyloxy group and an ethoxy group, which contribute to its unique properties, such as solubility and reactivity. The presence of these substituents can influence the compound's polarity and steric hindrance, affecting its interactions with other molecules. Typically, compounds like this are utilized in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals, where the acyl chloride can participate in acylation reactions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and moisture. Overall, 4-(Cyclopentyloxy)-3-ethoxybenzoyl chloride is a versatile chemical with potential applications in various fields of chemistry.
Formula:C14H17ClO3
InChI:InChI=1S/C14H17ClO3/c1-2-17-13-9-10(14(15)16)7-8-12(13)18-11-5-3-4-6-11/h7-9,11H,2-6H2,1H3
InChI key:InChIKey=HWZJYJRYGDAKNY-UHFFFAOYSA-N
SMILES:O(C1=C(OCC)C=C(C(Cl)=O)C=C1)C2CCCC2
Synonyms:- Benzoyl chloride, 4-(cyclopentyloxy)-3-ethoxy-
- 4-(Cyclopentyloxy)-3-ethoxybenzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.