CAS 1160249-51-3
:5-Bromo-2-(phenylmethoxy)benzoyl chloride
Description:
5-Bromo-2-(phenylmethoxy)benzoyl chloride is an organic compound characterized by the presence of a bromine atom, a phenylmethoxy group, and an acyl chloride functional group. This compound features a benzoyl moiety, which is a carbonyl group attached to a phenyl ring, and the presence of the chlorine atom enhances its reactivity, making it useful in various chemical reactions, particularly in acylation processes. The bromine substituent can also serve as a site for further functionalization or substitution reactions. The phenylmethoxy group contributes to the compound's lipophilicity and can influence its solubility and reactivity in organic solvents. Typically, compounds like this are utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to their ability to participate in nucleophilic substitution reactions. Safety precautions should be observed when handling this compound, as it may be corrosive and harmful upon exposure.
Formula:C14H10BrClO2
InChI:InChI=1S/C14H10BrClO2/c15-11-6-7-13(12(8-11)14(16)17)18-9-10-4-2-1-3-5-10/h1-8H,9H2
InChI key:InChIKey=PLMYJXRFBVUZFL-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(C(Cl)=O)C=C(Br)C=C2
Synonyms:- 5-Bromo-2-(phenylmethoxy)benzoyl chloride
- Benzoyl chloride, 5-bromo-2-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.