CAS 1160249-58-0
:4-[(4-Fluorophenyl)methoxy]benzoyl chloride
Description:
4-[(4-Fluorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its functional groups, including a benzoyl chloride moiety and a methoxy group attached to a fluorophenyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which can undergo nucleophilic substitution reactions. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and lipophilicity. This compound may be utilized in various synthetic applications, including the preparation of pharmaceuticals and agrochemicals, where it can serve as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this substance, as it may be corrosive and can release harmful gases upon reaction with water or moisture.
Formula:C14H10ClFO2
InChI:InChI=1S/C14H10ClFO2/c15-14(17)11-3-7-13(8-4-11)18-9-10-1-5-12(16)6-2-10/h1-8H,9H2
InChI key:InChIKey=LHZZLEMRDYVKIM-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(F)C=C1)C2=CC=C(C(Cl)=O)C=C2
Synonyms:- Benzoyl chloride, 4-[(4-fluorophenyl)methoxy]-
- 4-[(4-Fluorophenyl)methoxy]benzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.