CymitQuimica logo

CAS 1160249-64-8

:

4-[(2-Fluorophenyl)methoxy]benzoyl chloride

Description:
4-[(2-Fluorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its functional groups, which include a benzoyl chloride moiety and a methoxy group attached to a fluorophenyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of the acyl chloride functional group, making it a useful intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The fluorine atom in the 2-position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its biological activity or altering its reactivity. Additionally, this compound may exhibit moderate to high toxicity, necessitating careful handling and storage under appropriate safety protocols. Its solubility characteristics are generally favorable in organic solvents, which facilitates its use in various chemical reactions. As with many chlorinated compounds, it may also pose environmental concerns, warranting consideration during disposal and usage.
Formula:C14H10ClFO2
InChI:InChI=1S/C14H10ClFO2/c15-14(17)10-5-7-12(8-6-10)18-9-11-3-1-2-4-13(11)16/h1-8H,9H2
InChI key:InChIKey=GXPIZKOLAIUYPN-UHFFFAOYSA-N
SMILES:O(CC1=C(F)C=CC=C1)C2=CC=C(C(Cl)=O)C=C2
Synonyms:
  • 4-[(2-Fluorophenyl)methoxy]benzoyl chloride
  • Benzoyl chloride, 4-[(2-fluorophenyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.