CAS 1160249-68-2

4-[(4-Bromophenyl)methoxy]-3-methoxybenzoyl chloride

Description:

4-[(4-Bromophenyl)methoxy]-3-methoxybenzoyl chloride is an organic compound characterized by its complex structure, which includes a benzoyl chloride moiety substituted with methoxy and bromophenyl groups. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The bromophenyl and methoxy substituents contribute to its chemical properties, influencing its solubility and reactivity. It is often used in organic synthesis, particularly in the preparation of more complex molecules, including pharmaceuticals and agrochemicals. The presence of bromine in the structure may also impart unique electronic properties, making it a valuable intermediate in various chemical reactions. Safety precautions should be taken when handling this compound, as it may be corrosive and harmful upon exposure.

Formula: C₁₅H₁₂BrClO₃

InChI: InChI=1S/C15H12BrClO3/c1-19-14-8-11(15(17)18)4-7-13(14)20-9-10-2-5-12(16)6-3-10/h2-8H,9H2,1H3

InChI key: InChIKey=RWHRMUAPFIUZQQ-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(Br)C=C1)C2=C(OC)C=C(C(Cl)=O)C=C2

Synonyms:

• Benzoyl chloride, 4-[(4-bromophenyl)methoxy]-3-methoxy-
• 4-[(4-Bromophenyl)methoxy]-3-methoxybenzoyl chloride