CAS 1160249-86-4
:2-[(2-Fluorophenyl)methoxy]-3-methoxybenzoyl chloride
Description:
2-[(2-Fluorophenyl)methoxy]-3-methoxybenzoyl chloride is an organic compound characterized by its functional groups, which include a benzoyl chloride moiety and methoxy groups. The presence of the fluorophenyl group suggests that it may exhibit unique electronic properties due to the electronegative fluorine atom, potentially influencing its reactivity and interactions in chemical reactions. The compound is likely to be a white to off-white solid, soluble in organic solvents such as dichloromethane or acetone, but less soluble in water due to its hydrophobic characteristics. As a benzoyl chloride derivative, it is expected to be reactive, particularly towards nucleophiles, making it useful in various synthetic applications, including the formation of esters or amides. Additionally, the methoxy groups may enhance its lipophilicity and influence its biological activity, making it of interest in pharmaceutical research. Safety precautions should be taken when handling this compound, as benzoyl chlorides can be corrosive and may release harmful gases upon reaction with water or alcohols.
Formula:C15H12ClFO3
InChI:InChI=1S/C15H12ClFO3/c1-19-13-8-4-6-11(15(16)18)14(13)20-9-10-5-2-3-7-12(10)17/h2-8H,9H2,1H3
InChI key:InChIKey=CWVZWEHPZJHEEU-UHFFFAOYSA-N
SMILES:O(CC1=C(F)C=CC=C1)C2=C(C(Cl)=O)C=CC=C2OC
Synonyms:- 2-[(2-Fluorophenyl)methoxy]-3-methoxybenzoyl chloride
- Benzoyl chloride, 2-[(2-fluorophenyl)methoxy]-3-methoxy-
- 2-[(2-fluorobenzyl)oxy]-3-methoxybenzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.