CAS 1160250-13-4

Benzoyl chloride, 2-[(3-chlorophenyl)methoxy]-

Description:

Benzoyl chloride, 2-[(3-chlorophenyl)methoxy]- is an organic compound characterized by its functional groups, including a benzoyl chloride moiety and a methoxy group attached to a chlorophenyl ring. This compound typically appears as a colorless to pale yellow liquid with a pungent odor. It is known for its reactivity, particularly as an acylating agent, making it useful in organic synthesis, especially in the preparation of esters and amides. The presence of the chlorine atom in the chlorophenyl group can enhance its electrophilic character, facilitating various chemical reactions. Additionally, this compound is generally sensitive to moisture and can hydrolyze in the presence of water, releasing hydrochloric acid. Safety precautions are essential when handling this substance, as it can be corrosive and irritating to the skin, eyes, and respiratory system. Proper storage in a cool, dry place, away from incompatible materials, is recommended to maintain its stability and reactivity.

Formula: C₁₄H₁₀Cl₂O₂

InChI: InChI=1S/C14H10Cl2O2/c15-11-5-3-4-10(8-11)9-18-13-7-2-1-6-12(13)14(16)17/h1-8H,9H2

InChI key: InChIKey=DMBDEJFXGHBJKU-UHFFFAOYSA-N

SMILES: O(CC1=CC(Cl)=CC=C1)C2=C(C(Cl)=O)C=CC=C2

Synonyms:

• Benzoyl chloride, 2-[(3-chlorophenyl)methoxy]-