CAS 1160250-34-9

3-Methoxy-4-[(2-methylphenyl)methoxy]benzoyl chloride

Description:

3-Methoxy-4-[(2-methylphenyl)methoxy]benzoyl chloride is an organic compound characterized by its complex structure, which includes a benzoyl chloride moiety and methoxy groups. This compound features a benzene ring substituted with both methoxy and phenyl groups, contributing to its potential reactivity and solubility properties. The presence of the benzoyl chloride functional group indicates that it can participate in acylation reactions, making it useful in organic synthesis, particularly in the preparation of esters and amides. Its methoxy substituents may enhance its lipophilicity, influencing its behavior in biological systems and its application in pharmaceuticals or agrochemicals. The compound is likely to be a solid at room temperature, with a specific melting point and boiling point that would depend on its molecular interactions. Safety data should be consulted, as benzoyl chlorides can be reactive and may pose hazards such as skin and respiratory irritation. Overall, this compound's unique structure and functional groups suggest a range of potential applications in chemical synthesis and research.

Formula: C₁₆H₁₅ClO₃

InChI: InChI=1S/C16H15ClO3/c1-11-5-3-4-6-13(11)10-20-14-8-7-12(16(17)18)9-15(14)19-2/h3-9H,10H2,1-2H3

InChI key: InChIKey=LMXAWOGJURSJNB-UHFFFAOYSA-N

SMILES: O(CC1=C(C)C=CC=C1)C2=C(OC)C=C(C(Cl)=O)C=C2

Synonyms:

• 3-Methoxy-4-[(2-methylphenyl)methoxy]benzoyl chloride
• Benzoyl chloride, 3-methoxy-4-[(2-methylphenyl)methoxy]-