CAS 1160250-36-1

3-Bromo-4-ethoxy-5-methoxybenzoyl chloride

Description:

3-Bromo-4-ethoxy-5-methoxybenzoyl chloride is an organic compound characterized by its functional groups and structural features. It contains a benzoyl chloride moiety, which is a reactive acyl chloride, making it useful in acylation reactions. The presence of bromine and methoxy groups on the aromatic ring contributes to its reactivity and potential applications in organic synthesis. The ethoxy group enhances its solubility in organic solvents, facilitating its use in various chemical reactions. This compound is typically used in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals, due to its ability to introduce specific functional groups into target compounds. As with many halogenated compounds, it may exhibit biological activity, and safety precautions should be taken when handling it, as it can be corrosive and harmful. Proper storage and disposal methods are essential to mitigate environmental and health risks associated with its use.

Formula: C₁₀H₁₀BrClO₃

InChI: InChI=1S/C10H10BrClO3/c1-3-15-9-7(11)4-6(10(12)13)5-8(9)14-2/h4-5H,3H2,1-2H3

InChI key: InChIKey=OYLMRPYFVZUXOH-UHFFFAOYSA-N

SMILES: O(CC)C1=C(OC)C=C(C(Cl)=O)C=C1Br

Synonyms:

• Benzoyl chloride, 3-bromo-4-ethoxy-5-methoxy-
• 3-Bromo-4-ethoxy-5-methoxybenzoyl chloride