CAS 1160250-62-3
:2-[(2-Chloro-4-fluorophenyl)methoxy]benzoyl chloride
Description:
2-[(2-Chloro-4-fluorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its functional groups, including a benzoyl chloride moiety and a methoxy group attached to a chlorofluorophenyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The chlorofluorophenyl substituent contributes to its potential applications in pharmaceuticals and agrochemicals, as halogenated aromatic compounds often exhibit unique biological activities. Additionally, the compound may be sensitive to moisture and should be handled under anhydrous conditions to prevent hydrolysis of the acyl chloride. Safety precautions are essential, as it may be harmful if inhaled, ingested, or in contact with skin. Proper storage in a cool, dry place away from incompatible materials is recommended to maintain its stability and efficacy.
Formula:C14H9Cl2FO2
InChI:InChI=1S/C14H9Cl2FO2/c15-12-7-10(17)6-5-9(12)8-19-13-4-2-1-3-11(13)14(16)18/h1-7H,8H2
InChI key:InChIKey=FWIYECYGBFMIIZ-UHFFFAOYSA-N
SMILES:O(CC1=C(Cl)C=C(F)C=C1)C2=C(C(Cl)=O)C=CC=C2
Synonyms:- 2-[(2-Chloro-4-fluorophenyl)methoxy]benzoyl chloride
- Benzoyl chloride, 2-[(2-chloro-4-fluorophenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.