CymitQuimica logo

CAS 1160250-64-5

:

5-Bromo-2-[(2-chloro-4-fluorophenyl)methoxy]benzoyl chloride

Description:
5-Bromo-2-[(2-chloro-4-fluorophenyl)methoxy]benzoyl chloride is a chemical compound characterized by its complex structure, which includes a benzoyl chloride moiety and a methoxy group attached to a brominated benzene ring. This compound features a bromine atom and a chloro-fluoro-substituted phenyl group, contributing to its unique reactivity and potential applications in organic synthesis. The presence of the benzoyl chloride functional group indicates that it can participate in acylation reactions, making it useful in the synthesis of various derivatives. Additionally, the halogen substituents may influence its electronic properties, solubility, and biological activity. The compound is likely to be a solid at room temperature and may require careful handling due to the presence of reactive functional groups. Its specific applications could range from pharmaceutical intermediates to materials science, depending on the reactivity and stability of the compound in various conditions. As with all chemical substances, safety data and handling precautions should be consulted before use.
Formula:C14H8BrCl2FO2
InChI:InChI=1S/C14H8BrCl2FO2/c15-9-2-4-13(11(5-9)14(17)19)20-7-8-1-3-10(18)6-12(8)16/h1-6H,7H2
InChI key:InChIKey=ZILLAFWWGOGTHV-UHFFFAOYSA-N
SMILES:O(CC1=C(Cl)C=C(F)C=C1)C2=C(C(Cl)=O)C=C(Br)C=C2
Synonyms:
  • Benzoyl chloride, 5-bromo-2-[(2-chloro-4-fluorophenyl)methoxy]-
  • 5-Bromo-2-[(2-chloro-4-fluorophenyl)methoxy]benzoyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.