CymitQuimica logo

CAS 1160250-66-7

:

2-[(2-Chloro-4-fluorophenyl)methoxy]-3-methoxybenzoyl chloride

Description:
2-[(2-Chloro-4-fluorophenyl)methoxy]-3-methoxybenzoyl chloride is a chemical compound characterized by its complex structure, which includes a benzoyl chloride moiety and two methoxy groups. This compound features a chloro and a fluorine substituent on the aromatic ring, contributing to its unique reactivity and potential applications in organic synthesis. The presence of the benzoyl chloride functional group indicates that it can participate in acylation reactions, making it useful in the synthesis of various derivatives. The methoxy groups enhance its solubility in organic solvents and may influence its electronic properties, potentially affecting its reactivity. This compound is likely to be a solid at room temperature and may require careful handling due to the presence of reactive functional groups. Its applications could span pharmaceuticals, agrochemicals, or materials science, depending on the specific reactivity and properties it exhibits in various chemical environments. As with all chemical substances, safety precautions should be observed when handling this compound.
Formula:C15H11Cl2FO3
InChI:InChI=1S/C15H11Cl2FO3/c1-20-13-4-2-3-11(15(17)19)14(13)21-8-9-5-6-10(18)7-12(9)16/h2-7H,8H2,1H3
InChI key:InChIKey=MPNLJLCLSBHOHB-UHFFFAOYSA-N
SMILES:O(CC1=C(Cl)C=C(F)C=C1)C2=C(C(Cl)=O)C=CC=C2OC
Synonyms:
  • Benzoyl chloride, 2-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxy-
  • 2-[(2-Chloro-4-fluorophenyl)methoxy]-3-methoxybenzoyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.