CAS 1160250-68-9

4-[(2-Chloro-4-fluorophenyl)methoxy]benzoyl chloride

Description:

4-[(2-Chloro-4-fluorophenyl)methoxy]benzoyl chloride, identified by its CAS number 1160250-68-9, is an organic compound characterized by its functional groups, including a benzoyl chloride moiety and a methoxy group attached to a chlorofluorophenyl ring. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic substitution reactions. The chlorofluorophenyl group contributes to its potential applications in pharmaceuticals and agrochemicals, as halogenated aromatic compounds often exhibit enhanced biological activity. Additionally, the presence of the methoxy group can influence the compound's solubility and reactivity. Safety considerations are important when handling this substance, as it may be corrosive and can release harmful gases upon reaction with water or moisture. Overall, its unique structural features make it a compound of interest in synthetic organic chemistry.

Formula: C₁₄H₉Cl₂FO₂

InChI: InChI=1S/C14H9Cl2FO2/c15-13-7-11(17)4-1-10(13)8-19-12-5-2-9(3-6-12)14(16)18/h1-7H,8H2

InChI key: InChIKey=XXXKXVDLILPKKS-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=C(F)C=C1)C2=CC=C(C(Cl)=O)C=C2

Synonyms:

• 4-[(2-Chloro-4-fluorophenyl)methoxy]benzoyl chloride
• Benzoyl chloride, 4-[(2-chloro-4-fluorophenyl)methoxy]-