CAS 1160250-74-7
:3-[(4-Methylphenyl)methoxy]benzoyl chloride
Description:
3-[(4-Methylphenyl)methoxy]benzoyl chloride, identified by its CAS number 1160250-74-7, is an organic compound characterized by the presence of a benzoyl chloride functional group and a methoxy-substituted aromatic ring. This compound features a 4-methylphenyl group attached to a methoxy group, which is further connected to a benzoyl chloride moiety. The presence of the benzoyl chloride group indicates that it is a reactive acyl chloride, making it useful in various chemical reactions, particularly in acylation processes. The methoxy group contributes to its solubility and reactivity, while the methyl group on the phenyl ring can influence its electronic properties and steric hindrance. Typically, compounds like this are utilized in organic synthesis, pharmaceuticals, and as intermediates in the production of more complex molecules. Safety precautions should be observed when handling this compound due to the reactive nature of the acyl chloride functional group, which can release hydrochloric acid upon hydrolysis.
Formula:C15H13ClO2
InChI:InChI=1S/C15H13ClO2/c1-11-5-7-12(8-6-11)10-18-14-4-2-3-13(9-14)15(16)17/h2-9H,10H2,1H3
InChI key:InChIKey=MYZFENYWGQQYBS-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(C)C=C1)C2=CC(C(Cl)=O)=CC=C2
Synonyms:- 3-[(4-Methylphenyl)methoxy]benzoyl chloride
- Benzoyl chloride, 3-[(4-methylphenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.