CAS 1160250-76-9

3-Methoxy-4-[(4-methylphenyl)methoxy]benzoyl chloride

Description:

3-Methoxy-4-[(4-methylphenyl)methoxy]benzoyl chloride is an organic compound characterized by its complex structure, which includes a benzoyl chloride moiety and methoxy groups. This compound features a benzene ring substituted with both methoxy groups and a chlorobenzoyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the benzoyl chloride functional group indicates that it can participate in acylation reactions, making it useful in the synthesis of various derivatives. The methoxy groups enhance its solubility in organic solvents and may influence its electronic properties, potentially affecting its reactivity and interaction with other chemical species. Additionally, the presence of the 4-methylphenyl group adds steric bulk, which can impact the compound's behavior in chemical reactions. Overall, this compound is of interest in the field of medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of pharmaceuticals or other functional materials.

Formula: C₁₆H₁₅ClO₃

InChI: InChI=1S/C16H15ClO3/c1-11-3-5-12(6-4-11)10-20-14-8-7-13(16(17)18)9-15(14)19-2/h3-9H,10H2,1-2H3

InChI key: InChIKey=KEKDUQFRHCZZJV-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(C)C=C1)C2=C(OC)C=C(C(Cl)=O)C=C2

Synonyms:

• 3-Methoxy-4-[(4-methylphenyl)methoxy]benzoyl chloride
• Benzoyl chloride, 3-methoxy-4-[(4-methylphenyl)methoxy]-