CAS 1160250-78-1
:3-Ethoxy-4-[(4-methylphenyl)methoxy]benzoyl chloride
Description:
3-Ethoxy-4-[(4-methylphenyl)methoxy]benzoyl chloride is an organic compound characterized by its complex structure, which includes a benzoyl chloride moiety and ethoxy and methoxy substituents. This compound features a benzene ring with various functional groups that contribute to its chemical reactivity and properties. The presence of the benzoyl chloride group indicates that it can participate in acylation reactions, making it useful in organic synthesis. The ethoxy and methoxy groups enhance its solubility in organic solvents and may influence its biological activity. Typically, compounds like this may exhibit properties such as moderate to high reactivity, potential for use in pharmaceuticals or agrochemicals, and specific interactions with biological targets due to their structural features. Safety considerations should be taken into account, as benzoyl chlorides can be corrosive and may release hydrochloric acid upon hydrolysis. Overall, the characteristics of this compound suggest it has potential applications in synthetic chemistry and possibly in medicinal chemistry, depending on its specific interactions and reactivity.
Formula:C17H17ClO3
InChI:InChI=1S/C17H17ClO3/c1-3-20-16-10-14(17(18)19)8-9-15(16)21-11-13-6-4-12(2)5-7-13/h4-10H,3,11H2,1-2H3
InChI key:InChIKey=HFKNTRNWYMKVPS-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OCC2=CC=C(C)C=C2)C=CC(C(Cl)=O)=C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.