CAS 1160250-91-8

2-[(2,6-Dichlorophenyl)methoxy]benzoyl chloride

Description:

2-[(2,6-Dichlorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its structure, which includes a benzoyl chloride moiety and a methoxy group attached to a dichlorophenyl ring. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the acyl chloride functional group, which can readily undergo nucleophilic substitution reactions. The dichlorophenyl group contributes to its potential biological activity and lipophilicity, making it of interest in pharmaceutical and agrochemical applications. The presence of chlorine atoms enhances its stability and can influence its interaction with biological targets. Additionally, this compound may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many chlorinated organic compounds. Safety precautions should be taken when handling this substance, as it may be corrosive and harmful upon exposure.

Formula: C₁₄H₉Cl₃O₂

InChI: InChI=1S/C14H9Cl3O2/c15-11-5-3-6-12(16)10(11)8-19-13-7-2-1-4-9(13)14(17)18/h1-7H,8H2

InChI key: InChIKey=NXAYYQADJCHQDJ-UHFFFAOYSA-N

SMILES: C(OC1=C(C(Cl)=O)C=CC=C1)C2=C(Cl)C=CC=C2Cl

Synonyms:

• 2-[(2,6-Dichlorophenyl)methoxy]benzoyl chloride
• Benzoyl chloride, 2-[(2,6-dichlorophenyl)methoxy]-