CAS 1160250-93-0

Benzoyl chloride, 2-[(3-methylphenyl)methoxy]-

Description:

Benzoyl chloride, 2-[(3-methylphenyl)methoxy]- is an organic compound characterized by the presence of a benzoyl chloride functional group and a methoxy group attached to a substituted aromatic ring. This compound typically exhibits a colorless to pale yellow liquid form and has a pungent odor, characteristic of acyl chlorides. It is known for its reactivity, particularly in acylation reactions, where it can act as an acylating agent due to the presence of the reactive carbonyl group. The methoxy group enhances its solubility in organic solvents and may influence its reactivity and stability. As with many acyl chlorides, it is sensitive to moisture and can hydrolyze in the presence of water, releasing hydrochloric acid. Safety precautions are essential when handling this compound, as it can cause severe irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place, away from moisture and incompatible substances, is crucial to maintain its integrity and prevent hazardous reactions.

Formula: C₁₅H₁₃ClO₂

InChI: InChI=1S/C15H13ClO2/c1-11-5-4-6-12(9-11)10-18-14-8-3-2-7-13(14)15(16)17/h2-9H,10H2,1H3

InChI key: InChIKey=XBCXZEBREXOXJN-UHFFFAOYSA-N

SMILES: O(CC1=CC(C)=CC=C1)C2=C(C(Cl)=O)C=CC=C2

Synonyms:

• Benzoyl chloride, 2-[(3-methylphenyl)methoxy]-
• 2-[(3-methylbenzyl)oxy]benzoyl chloride