CAS 1160250-95-2

4-[(2,6-Dichlorophenyl)methoxy]benzoyl chloride

Description:

4-[(2,6-Dichlorophenyl)methoxy]benzoyl chloride, identified by its CAS number 1160250-95-2, is an organic compound characterized by the presence of a benzoyl chloride functional group and a methoxy substituent attached to a dichlorophenyl moiety. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The dichlorophenyl group contributes to its potential biological activity and may influence its solubility and stability in various solvents. This compound is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an acylating agent. Safety precautions should be observed when handling this substance, as it may be corrosive and can release harmful gases upon reaction with water or moisture.

Formula: C₁₄H₉Cl₃O₂

InChI: InChI=1S/C14H9Cl3O2/c15-12-2-1-3-13(16)11(12)8-19-10-6-4-9(5-7-10)14(17)18/h1-7H,8H2

InChI key: InChIKey=WEGJPSPWMUXRIO-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(C(Cl)=O)C=C1)C2=C(Cl)C=CC=C2Cl

Synonyms:

• Benzoyl chloride, 4-[(2,6-dichlorophenyl)methoxy]-
• 4-[(2,6-Dichlorophenyl)methoxy]benzoyl chloride