CAS 1160250-99-6
:5-Bromo-2-[(3-methylphenyl)methoxy]benzoyl chloride
Description:
5-Bromo-2-[(3-methylphenyl)methoxy]benzoyl chloride is an organic compound characterized by its complex structure, which includes a bromine atom, a methoxy group, and a benzoyl chloride functional group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic substitution reactions. The bromine substituent can influence the compound's electronic properties and reactivity, while the methoxy group can enhance solubility in organic solvents. This compound is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in various chemical reactions. Safety precautions should be observed when handling this compound, as it may be hazardous and can cause irritation upon contact with skin or mucous membranes. Proper storage and disposal methods should be followed to mitigate any environmental impact.
Formula:C15H12BrClO2
InChI:InChI=1S/C15H12BrClO2/c1-10-3-2-4-11(7-10)9-19-14-6-5-12(16)8-13(14)15(17)18/h2-8H,9H2,1H3
InChI key:InChIKey=OSXUNXUYAUHVAJ-UHFFFAOYSA-N
SMILES:O(CC1=CC(C)=CC=C1)C2=C(C(Cl)=O)C=C(Br)C=C2
Synonyms:- 5-Bromo-2-[(3-methylphenyl)methoxy]benzoyl chloride
- Benzoyl chloride, 5-bromo-2-[(3-methylphenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.