CymitQuimica logo

CAS 1160251-01-3

:

2-[(2,6-Dichlorophenyl)methoxy]-3-methoxybenzoyl chloride

Description:
2-[(2,6-Dichlorophenyl)methoxy]-3-methoxybenzoyl chloride is an organic compound characterized by its complex structure, which includes a benzoyl chloride moiety and two methoxy groups attached to a phenyl ring. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms at the 2 and 6 positions of the phenyl ring, which can significantly influence its reactivity and physical properties. The methoxy groups contribute to its solubility and polarity, making it more amenable to various chemical reactions. As a benzoyl chloride derivative, it is likely to exhibit reactivity typical of acyl chlorides, such as undergoing nucleophilic acyl substitution. This compound may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may be corrosive and pose health risks upon exposure.
Formula:C15H11Cl3O3
InChI:InChI=1S/C15H11Cl3O3/c1-20-13-7-2-4-9(15(18)19)14(13)21-8-10-11(16)5-3-6-12(10)17/h2-7H,8H2,1H3
InChI key:InChIKey=BIWYMEPBMCNRSC-UHFFFAOYSA-N
SMILES:O(CC1=C(Cl)C=CC=C1Cl)C2=C(C(Cl)=O)C=CC=C2OC
Synonyms:
  • Benzoyl chloride, 2-[(2,6-dichlorophenyl)methoxy]-3-methoxy-
  • 2-[(2,6-Dichlorophenyl)methoxy]-3-methoxybenzoyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.