CAS 1160251-13-7

3-Ethoxy-4-[(3-fluorophenyl)methoxy]benzoyl chloride

Description:

3-Ethoxy-4-[(3-fluorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its complex structure, which includes a benzoyl chloride moiety and ethoxy and methoxy substituents. This compound features a benzene ring with various functional groups that contribute to its reactivity and potential applications in organic synthesis. The presence of the benzoyl chloride group indicates that it can participate in acylation reactions, making it useful in the synthesis of more complex molecules. The ethoxy and methoxy groups enhance its solubility in organic solvents and may influence its electronic properties, potentially affecting its reactivity. Additionally, the fluorine atom in the 3-fluorophenyl group can impart unique characteristics, such as increased lipophilicity and altered biological activity. Overall, this compound is of interest in medicinal chemistry and materials science, where its reactivity and functionalization potential can be exploited for the development of pharmaceuticals or advanced materials. Safety precautions should be taken when handling this compound due to the presence of reactive functional groups.

Formula: C₁₆H₁₄ClFO₃

InChI: InChI=1S/C16H14ClFO3/c1-2-20-15-9-12(16(17)19)6-7-14(15)21-10-11-4-3-5-13(18)8-11/h3-9H,2,10H2,1H3

InChI key: InChIKey=NLFPCILIVWVYMR-UHFFFAOYSA-N

SMILES: O(CC1=CC(F)=CC=C1)C2=C(OCC)C=C(C(Cl)=O)C=C2