CAS 1160251-19-3

3-Ethoxy-4-[(3-methylphenyl)methoxy]benzoyl chloride

Description:

3-Ethoxy-4-[(3-methylphenyl)methoxy]benzoyl chloride is an organic compound characterized by its complex structure, which includes a benzoyl chloride functional group, an ethoxy group, and a methoxy-substituted aromatic ring. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it possesses both hydrophobic and hydrophilic characteristics, which can influence its solubility and reactivity. The presence of the benzoyl chloride moiety indicates that it can participate in nucleophilic substitution reactions, making it a versatile building block in synthetic chemistry. Additionally, the ethoxy and methoxy groups can affect the compound's electronic properties and steric hindrance, potentially impacting its biological activity. Safety data sheets would typically indicate that it should be handled with care due to its reactive nature, particularly in the presence of nucleophiles. Overall, this compound exemplifies the complexity and utility of substituted aromatic compounds in chemical synthesis.

Formula: C₁₇H₁₇ClO₃

InChI: InChI=1S/C17H17ClO3/c1-3-20-16-10-14(17(18)19)7-8-15(16)21-11-13-6-4-5-12(2)9-13/h4-10H,3,11H2,1-2H3

InChI key: InChIKey=KMLCXJRBYRXBTP-UHFFFAOYSA-N

SMILES: O(CC1=CC(C)=CC=C1)C2=C(OCC)C=C(C(Cl)=O)C=C2

Synonyms:

• Benzoyl chloride, 3-ethoxy-4-[(3-methylphenyl)methoxy]-
• 3-Ethoxy-4-[(3-methylphenyl)methoxy]benzoyl chloride