CAS 1160251-29-5

4-[(3,4-Dichlorophenyl)methoxy]-3-ethoxybenzoyl chloride

Description:

4-[(3,4-Dichlorophenyl)methoxy]-3-ethoxybenzoyl chloride is an organic compound characterized by its complex structure, which includes a benzoyl chloride moiety and a methoxy group attached to a dichlorophenyl ring. This compound features a dichlorinated aromatic system, which often contributes to its biological activity and potential applications in pharmaceuticals or agrochemicals. The presence of the ethoxy group enhances its solubility in organic solvents, making it suitable for various synthetic processes. As a benzoyl chloride derivative, it is likely to be reactive, particularly in nucleophilic substitution reactions, where it can act as an acylating agent. The dichlorophenyl substituent may impart specific electronic properties, influencing the compound's reactivity and interaction with biological targets. Safety considerations are essential when handling this compound, as benzoyl chlorides can be corrosive and may release harmful gases upon reaction with water or alcohols. Overall, this compound's unique structural features suggest potential utility in chemical synthesis and medicinal chemistry.

Formula: C₁₆H₁₃Cl₃O₃

InChI: InChI=1S/C16H13Cl3O3/c1-2-21-15-8-11(16(19)20)4-6-14(15)22-9-10-3-5-12(17)13(18)7-10/h3-8H,2,9H2,1H3

InChI key: InChIKey=LBWRJVZXUYDTOA-UHFFFAOYSA-N

SMILES: O(CC1=CC(Cl)=C(Cl)C=C1)C2=C(OCC)C=C(C(Cl)=O)C=C2

Synonyms:

• Benzoyl chloride, 4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-
• 4-[(3,4-Dichlorophenyl)methoxy]-3-ethoxybenzoyl chloride