CAS 1160253-09-7

6-Bromo-2-(2-ethoxyphenyl)-4-quinolinecarbonyl chloride

Description:

6-Bromo-2-(2-ethoxyphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety, a bromine atom, and an ethoxyphenyl group. This compound features a carbonyl chloride functional group, which makes it a reactive acyl chloride, allowing it to participate in various chemical reactions, such as acylation and nucleophilic substitution. The presence of the bromine atom introduces additional reactivity and can influence the compound's biological activity. The ethoxyphenyl group contributes to the compound's lipophilicity, potentially affecting its solubility and interaction with biological systems. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the synthesis of biologically active molecules. Its unique structural features suggest that it could exhibit interesting pharmacological properties, although specific biological activities would need to be investigated through experimental studies. Overall, 6-Bromo-2-(2-ethoxyphenyl)-4-quinolinecarbonyl chloride represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₁₈H₁₃BrClNO₂

InChI: InChI=1S/C18H13BrClNO2/c1-2-23-17-6-4-3-5-12(17)16-10-14(18(20)22)13-9-11(19)7-8-15(13)21-16/h3-10H,2H2,1H3

InChI key: InChIKey=ZFIAPLNJOOGSQV-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=C(Br)C=C3)C=CC=C1

Synonyms:

• 6-Bromo-2-(2-ethoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 6-bromo-2-(2-ethoxyphenyl)-