CAS 1160253-33-7
:6-Methyl-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride
Description:
6-Methyl-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline core, a thienyl group, and a carbonyl chloride functional group. The presence of the methyl groups contributes to its hydrophobic nature, while the carbonyl chloride group indicates that it is a reactive acyl chloride, making it useful in various synthetic applications, particularly in the formation of amides and esters. This compound may exhibit biological activity due to its heterocyclic structure, which is often associated with pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's reactivity and stability under certain conditions can influence its handling and storage requirements in laboratory settings. As with many organic compounds, safety precautions should be taken when working with it, given the potential hazards associated with carbonyl chlorides, including corrosiveness and toxicity.
Formula:C16H12ClNOS
InChI:InChI=1S/C16H12ClNOS/c1-9-3-5-13-11(7-9)12(16(17)19)8-14(18-13)15-6-4-10(2)20-15/h3-8H,1-2H3
InChI key:InChIKey=BAYPUMRXYMXGSC-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C)S3)C=CC(C)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6-methyl-2-(5-methyl-2-thienyl)-
- 6-Methyl-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.