CAS 1160253-35-9

2-(5-Ethyl-2-thienyl)-6-methyl-4-quinolinecarbonyl chloride

Description:

2-(5-Ethyl-2-thienyl)-6-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline backbone substituted with both thienyl and ethyl groups. The presence of a carbonyl chloride functional group indicates that it is a reactive acyl chloride, making it useful in various synthetic applications, particularly in the formation of amides and esters. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic and heterocyclic components, which can influence its solubility and reactivity in organic solvents. Additionally, the thienyl group may impart specific electronic properties, potentially affecting its reactivity and interaction with biological systems. As with many acyl chlorides, it may be sensitive to moisture and should be handled with care to avoid hydrolysis. Overall, this compound's structural features suggest potential applications in medicinal chemistry and organic synthesis, although specific biological activities or applications would require further investigation.

Formula: C₁₇H₁₄ClNOS

InChI: InChI=1S/C17H14ClNOS/c1-3-11-5-7-16(21-11)15-9-13(17(18)20)12-8-10(2)4-6-14(12)19-15/h4-9H,3H2,1-2H3

InChI key: InChIKey=SAZUDDBYRGFYIB-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C=3SC(CC)=CC3)C=CC(C)=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(5-ethyl-2-thienyl)-6-methyl-
• 2-(5-Ethyl-2-thienyl)-6-methyl-4-quinolinecarbonyl chloride
• 2-(5-ethyl-2-thienyl)-6-methylquinoline-4-carbonyl chloride
• 4-quinolinecarbonyl chloride, 2-(5-ethyl-2-thienyl)-6-meth