CAS 1160253-43-9
:6-Methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride
Description:
6-Methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This compound features a carbonyl chloride functional group, indicating the presence of a carbon atom double-bonded to an oxygen atom and single-bonded to a chlorine atom, which makes it a reactive acyl chloride. The presence of the methyl groups on both the quinoline and phenyl rings contributes to its hydrophobic nature and may influence its reactivity and solubility in organic solvents. The compound is likely to be used in organic synthesis, particularly in the preparation of other chemical entities, due to the reactivity of the carbonyl chloride group. Additionally, its structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research and development. Safety precautions should be taken when handling this compound, as carbonyl chlorides can be corrosive and harmful.
Formula:C18H14ClNO
InChI:InChI=1S/C18H14ClNO/c1-11-3-6-13(7-4-11)17-10-15(18(19)21)14-9-12(2)5-8-16(14)20-17/h3-10H,1-2H3
InChI key:InChIKey=XINBKQXTKABPQW-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C)C=C3)C=CC(C)=C2
Synonyms:- 6-Methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 6-methyl-2-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
